C26H32N4O4Si — CID 171635220
2-methyl-3-[3-methyl-2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoic acid (PubChem CID 171635220) has the molecular formula C26H32N4O4Si and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-methyl-3-[3-methyl-2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoic acid.
| Compound Name | 2-methyl-3-[3-methyl-2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 171635220 |
| Molecular Formula | C26H32N4O4Si |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-methyl-3-[3-methyl-2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoic acid |
| SMILES | Cc1c(Oc2ccnc3c2c(C)c(-c2cnn(C)c2)n3COCC[Si](C)(C)C)cccc1C(=O)O |
| InChI | InChI=1S/C26H32N4O4Si/c1-17-20(26(31)32)8-7-9-21(17)34-22-10-11-27-25-23(22)18(2)24(19-14-28-29(3)15-19)30(25)16-33-12-13-35(4,5)6/h7-11,14-15H,12-13,16H2,1-6H3,(H,31,32) |
| InChIKey | YFHDHYUFUDXBDA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|