C30H38N6O4Si — CID 67361652
[(1S,3R)-3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid (PubChem CID 67361652) has the molecular formula C30H38N6O4Si and a molecular weight of 574.76 g/mol. Its IUPAC name is [(1S,3R)-3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid.
| Compound Name | [(1S,3R)-3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 67361652 |
| Molecular Formula | C30H38N6O4Si |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [(1S,3R)-3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(ncc4cnc([C@@H]5CC[C@H](NC(=O)O)C5)n43)n1COCC[Si](C)(C)C)cn2C |
| InChI | InChI=1S/C30H38N6O4Si/c1-34-17-24(23-13-22(39-2)8-9-25(23)34)26-14-27-29(35(26)18-40-10-11-41(3,4)5)32-16-21-15-31-28(36(21)27)19-6-7-20(12-19)33-30(37)38/h8-9,13-17,19-20,33H,6-7,10-12,18H2,1-5H3,(H,37,38)/t19-,20+/m1/s1 |
| InChIKey | JXVVEJMHORDRLY-UXHICEINSA-N |
| XLogP | 6.07 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|