C32H44N6O4Si — CID 58382389
tert-butyl N-[3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]propyl]carbamate (PubChem CID 58382389) has the molecular formula C32H44N6O4Si and a molecular weight of 604.83 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]propyl]carbamate |
|---|---|
| PubChem CID | 58382389 |
| Molecular Formula | C32H44N6O4Si |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | tert-butyl N-[3-[4-(5-methoxy-1-methylindol-3-yl)-5-(2-trimethylsilylethoxymethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]propyl]carbamate |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(ncc4cnc(CCCNC(=O)OC(C)(C)C)n43)n1COCC[Si](C)(C)C)cn2C |
| InChI | InChI=1S/C32H44N6O4Si/c1-32(2,3)42-31(39)33-13-9-10-29-34-18-22-19-35-30-28(38(22)29)17-27(37(30)21-41-14-15-43(6,7)8)25-20-36(4)26-12-11-23(40-5)16-24(25)26/h11-12,16-20H,9-10,13-15,21H2,1-8H3,(H,33,39) |
| InChIKey | SODQHRKGHKHAPO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|