C21H21N5O3 — CID 67363247
[(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid (PubChem CID 67363247) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is [(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid.
| Compound Name | [(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 67363247 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]carbamic acid |
| SMILES | COc1ccc(-c2nc([C@@H]3CC[C@H](NC(=O)O)C3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-29-15-6-3-12(4-7-15)18-17-11-23-19-16(8-9-22-19)26(17)20(25-18)13-2-5-14(10-13)24-21(27)28/h3-4,6-9,11,13-14,22,24H,2,5,10H2,1H3,(H,27,28)/t13-,14+/m1/s1 |
| InChIKey | OFNCTGCGZZTSBK-KGLIPLIRSA-N |
| XLogP | 3.79 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |