C20H22N6O — CID 67363526
10-(4-methoxyphenyl)-12-(piperazin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 67363526) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-12-(piperazin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(4-methoxyphenyl)-12-(piperazin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 67363526 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 10-(4-methoxyphenyl)-12-(piperazin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc(-c2nc(CN3CCNCC3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C20H22N6O/c1-27-15-4-2-14(3-5-15)19-17-12-23-20-16(6-7-22-20)26(17)18(24-19)13-25-10-8-21-9-11-25/h2-7,12,21-22H,8-11,13H2,1H3 |
| InChIKey | VUWPVMIDPWDDFP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |