C18H18N4O2 — CID 58382208
12-(2-methoxyethyl)-10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382208) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 12-(2-methoxyethyl)-10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-(2-methoxyethyl)-10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382208 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 12-(2-methoxyethyl)-10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COCCc1nc(-c2ccc(OC)cc2)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H18N4O2/c1-23-10-8-16-21-17(12-3-5-13(24-2)6-4-12)15-11-20-18-14(22(15)16)7-9-19-18/h3-7,9,11,19H,8,10H2,1-2H3 |
| InChIKey | HIMAFUMLEGGLFB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |