C23H28N6O — CID 58382428
2-[4-[12-[(4-aminopiperidin-1-yl)methyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol (PubChem CID 58382428) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[4-[12-[(4-aminopiperidin-1-yl)methyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[12-[(4-aminopiperidin-1-yl)methyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 58382428 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[4-[12-[(4-aminopiperidin-1-yl)methyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(-c2nc(CN3CCC(N)CC3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C23H28N6O/c1-23(2,30)16-5-3-15(4-6-16)21-19-13-26-22-18(7-10-25-22)29(19)20(27-21)14-28-11-8-17(24)9-12-28/h3-7,10,13,17,25,30H,8-9,11-12,14,24H2,1-2H3 |
| InChIKey | ZLXVBBHPBOKNPU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |