C17H14N4O3 — CID 67360690
2-methoxy-5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)benzoic acid (PubChem CID 67360690) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-methoxy-5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)benzoic acid.
| Compound Name | 2-methoxy-5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)benzoic acid |
|---|---|
| PubChem CID | 67360690 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-methoxy-5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)benzoic acid |
| SMILES | COc1ccc(-c2nc(C)n3c2cnc2[nH]ccc23)cc1C(=O)O |
| InChI | InChI=1S/C17H14N4O3/c1-9-20-15(10-3-4-14(24-2)11(7-10)17(22)23)13-8-19-16-12(21(9)13)5-6-18-16/h3-8,18H,1-2H3,(H,22,23) |
| InChIKey | FABXKIBTKBHXHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |