C15H13N5O — CID 58382059
[5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-2-pyridinyl]methanol (PubChem CID 58382059) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is [5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-2-pyridinyl]methanol.
| Compound Name | [5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 58382059 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [5-(12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-2-pyridinyl]methanol |
| SMILES | Cc1nc(-c2ccc(CO)nc2)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C15H13N5O/c1-9-19-14(10-2-3-11(8-21)17-6-10)13-7-18-15-12(20(9)13)4-5-16-15/h2-7,16,21H,8H2,1H3 |
| InChIKey | NFCDVRMIKLLHAN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |