C21H23N5O — CID 58382321
10-(4-methoxyphenyl)-12-(piperidin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382321) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-12-(piperidin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(4-methoxyphenyl)-12-(piperidin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382321 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 10-(4-methoxyphenyl)-12-(piperidin-1-ylmethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc(-c2nc(CN3CCCCC3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-27-16-7-5-15(6-8-16)20-18-13-23-21-17(9-10-22-21)26(18)19(24-20)14-25-11-3-2-4-12-25/h5-10,13,22H,2-4,11-12,14H2,1H3 |
| InChIKey | DHTGUPXUFTZDHS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |