C21H23N5O — CID 67361336
cis-(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclohexan-1-amine (PubChem CID 67361336) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is cis-(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclohexan-1-amine.
| Compound Name | cis-(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 67361336 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | cis-(1S,3R)-3-[10-(4-methoxyphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclohexan-1-amine |
| SMILES | COc1ccc(-c2nc([C@@H]3CCC[C@H](N)C3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-27-16-7-5-13(6-8-16)19-18-12-24-20-17(9-10-23-20)26(18)21(25-19)14-3-2-4-15(22)11-14/h5-10,12,14-15,23H,2-4,11,22H2,1H3/t14-,15+/m1/s1 |
| InChIKey | WZKASQCIRPGOAB-CABCVRRESA-N |
| XLogP | 3.87 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |