C24H29N5O — CID 123311366
2-[4-[12-[2-(aminomethyl)cyclohexyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol (PubChem CID 123311366) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[4-[12-[2-(aminomethyl)cyclohexyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[12-[2-(aminomethyl)cyclohexyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123311366 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 2-[4-[12-[2-(aminomethyl)cyclohexyl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(-c2nc(C3CCCCC3CN)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C24H29N5O/c1-24(2,30)17-9-7-15(8-10-17)21-20-14-27-22-19(11-12-26-22)29(20)23(28-21)18-6-4-3-5-16(18)13-25/h7-12,14,16,18,26,30H,3-6,13,25H2,1-2H3 |
| InChIKey | PIAZUXVJHSWHCQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |