C16H20N2OS — CID 84570130
4-(4-methoxyphenyl)-2-(piperidin-1-ylmethyl)-1,3-thiazole (PubChem CID 84570130) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(piperidin-1-ylmethyl)-1,3-thiazole.
| Compound Name | 4-(4-methoxyphenyl)-2-(piperidin-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 84570130 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(piperidin-1-ylmethyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(CN3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C16H20N2OS/c1-19-14-7-5-13(6-8-14)15-12-20-16(17-15)11-18-9-3-2-4-10-18/h5-8,12H,2-4,9-11H2,1H3 |
| InChIKey | XVLYNOUIOZRRDE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |