C22H20N2O — CID 175083824
5-[4-[1-(4-methoxyphenyl)ethyl]phenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 175083824) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-[4-[1-(4-methoxyphenyl)ethyl]phenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-[4-[1-(4-methoxyphenyl)ethyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 175083824 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 5-[4-[1-(4-methoxyphenyl)ethyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(C(C)c2ccc(-c3cnc4[nH]ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-15(17-7-9-21(25-2)10-8-17)16-3-5-18(6-4-16)20-13-19-11-12-23-22(19)24-14-20/h3-15H,1-2H3,(H,23,24) |
| InChIKey | NCHGPCBFJVABHD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |