C11H18N6O3Si — CID 10710093
4-oxo-3-(2-trimethylsilylethoxymethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 10710093) has the molecular formula C11H18N6O3Si and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-oxo-3-(2-trimethylsilylethoxymethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | 4-oxo-3-(2-trimethylsilylethoxymethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 10710093 |
| Molecular Formula | C11H18N6O3Si |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-oxo-3-(2-trimethylsilylethoxymethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nnc2c(C(N)=O)ncn2c1=O |
| InChI | InChI=1S/C11H18N6O3Si/c1-21(2,3)5-4-20-7-17-11(19)16-6-13-8(9(12)18)10(16)14-15-17/h6H,4-5,7H2,1-3H3,(H2,12,18) |
| InChIKey | XTAAYHOHCWQHCR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|