C24H38N2O6Si — CID 161423434
2-oxaspiro[3.5]nonan-7-one;1-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-indazole-5,3'-oxetane]-3-carboxylic acid (PubChem CID 161423434) has the molecular formula C24H38N2O6Si and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-oxaspiro[3.5]nonan-7-one;1-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-indazole-5,3'-oxetane]-3-carboxylic acid.
| Compound Name | 2-oxaspiro[3.5]nonan-7-one;1-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-indazole-5,3'-oxetane]-3-carboxylic acid |
|---|---|
| PubChem CID | 161423434 |
| Molecular Formula | C24H38N2O6Si |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-oxaspiro[3.5]nonan-7-one;1-(2-trimethylsilylethoxymethyl)spiro[6,7-dihydro-4H-indazole-5,3'-oxetane]-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2c1CCC1(COC1)C2.O=C1CCC2(CC1)COC2 |
| InChI | InChI=1S/C16H26N2O4Si.C8H12O2/c1-23(2,3)7-6-21-11-18-13-4-5-16(9-22-10-16)8-12(13)14(17-18)15(19)20;9-7-1-3-8(4-2-7)5-10-6-8/h4-11H2,1-3H3,(H,19,20);1-6H2 |
| InChIKey | VXAQGHOVTWRYFY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|