C22H35N3O4Si — CID 68612698
5-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,3-dihydroindazole-3-carboxylic acid (PubChem CID 68612698) has the molecular formula C22H35N3O4Si and a molecular weight of 433.63 g/mol. Its IUPAC name is 5-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,3-dihydroindazole-3-carboxylic acid.
| Compound Name | 5-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,3-dihydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68612698 |
| Molecular Formula | C22H35N3O4Si |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 5-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2-(2-trimethylsilylethoxymethyl)-1,3-dihydroindazole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN1Nc2ccc(N3CCC(OCC4CC4)C3)cc2C1C(=O)O |
| InChI | InChI=1S/C22H35N3O4Si/c1-30(2,3)11-10-28-15-25-21(22(26)27)19-12-17(6-7-20(19)23-25)24-9-8-18(13-24)29-14-16-4-5-16/h6-7,12,16,18,21,23H,4-5,8-11,13-15H2,1-3H3,(H,26,27) |
| InChIKey | QBWFQPYEZHKYMN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|