C36H50N4O6 — CID 142327525
ethane;N-formyl-2-[5-[4-[[1-(4-formylphenyl)pyrrolidin-3-yl]oxymethyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]pentanamide;propane (PubChem CID 142327525) has the molecular formula C36H50N4O6 and a molecular weight of 634.82 g/mol. Its IUPAC name is ethane;N-formyl-2-[5-[4-[[1-(4-formylphenyl)pyrrolidin-3-yl]oxymethyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]pentanamide;propane.
| Compound Name | ethane;N-formyl-2-[5-[4-[[1-(4-formylphenyl)pyrrolidin-3-yl]oxymethyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]pentanamide;propane |
|---|---|
| PubChem CID | 142327525 |
| Molecular Formula | C36H50N4O6 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | ethane;N-formyl-2-[5-[4-[[1-(4-formylphenyl)pyrrolidin-3-yl]oxymethyl]piperidin-1-yl]-1,3-dioxoisoindol-2-yl]pentanamide;propane |
| SMILES | CC.CCC.CCCC(C(=O)NC=O)N1C(=O)c2ccc(N3CCC(COC4CCN(c5ccc(C=O)cc5)C4)CC3)cc2C1=O |
| InChI | InChI=1S/C31H36N4O6.C3H8.C2H6/c1-2-3-28(29(38)32-20-37)35-30(39)26-9-8-24(16-27(26)31(35)40)33-13-10-22(11-14-33)19-41-25-12-15-34(17-25)23-6-4-21(18-36)5-7-23;1-3-2;1-2/h4-9,16,18,20,22,25,28H,2-3,10-15,17,19H2,1H3,(H,32,37,38);3H2,1-2H3;1-2H3 |
| InChIKey | PFZOEPYILNHHKS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|