C26H36BrN5O2Si — CID 87342961
(2-bromo-4-pyridinyl)-[6-[4-(dimethylamino)piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone (PubChem CID 87342961) has the molecular formula C26H36BrN5O2Si and a molecular weight of 558.60 g/mol. Its IUPAC name is (2-bromo-4-pyridinyl)-[6-[4-(dimethylamino)piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone.
| Compound Name | (2-bromo-4-pyridinyl)-[6-[4-(dimethylamino)piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone |
|---|---|
| PubChem CID | 87342961 |
| Molecular Formula | C26H36BrN5O2Si |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (2-bromo-4-pyridinyl)-[6-[4-(dimethylamino)piperidin-1-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methanone |
| SMILES | CN(C)C1CCN(c2ccc3nc(C(=O)c4ccnc(Br)c4)n(COCC[Si](C)(C)C)c3c2)CC1 |
| InChI | InChI=1S/C26H36BrN5O2Si/c1-30(2)20-9-12-31(13-10-20)21-6-7-22-23(17-21)32(18-34-14-15-35(3,4)5)26(29-22)25(33)19-8-11-28-24(27)16-19/h6-8,11,16-17,20H,9-10,12-15,18H2,1-5H3 |
| InChIKey | CHQCYZZBSPXBAT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|