C28H34N4O3Si — CID 156792710
ethyl 4-[3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzoate (PubChem CID 156792710) has the molecular formula C28H34N4O3Si and a molecular weight of 502.69 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzoate.
| Compound Name | ethyl 4-[3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzoate |
|---|---|
| PubChem CID | 156792710 |
| Molecular Formula | C28H34N4O3Si |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | ethyl 4-[3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc3c(c2)c(/C=C/c2cnn(C)c2)nn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C28H34N4O3Si/c1-6-35-28(33)23-10-8-22(9-11-23)24-12-14-27-25(17-24)26(13-7-21-18-29-31(2)19-21)30-32(27)20-34-15-16-36(3,4)5/h7-14,17-19H,6,15-16,20H2,1-5H3/b13-7+ |
| InChIKey | FIBKHXQNWGIHCA-NTUHNPAUSA-N |
| XLogP | 6.10 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|