C29H32N2OSi — CID 69371688
trimethyl-[2-[[6-(1-phenylethenyl)-3-(2-phenylethenyl)indazol-1-yl]methoxy]ethyl]silane (PubChem CID 69371688) has the molecular formula C29H32N2OSi and a molecular weight of 452.67 g/mol. Its IUPAC name is trimethyl-[2-[[6-(1-phenylethenyl)-3-(2-phenylethenyl)indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[6-(1-phenylethenyl)-3-(2-phenylethenyl)indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 69371688 |
| Molecular Formula | C29H32N2OSi |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | trimethyl-[2-[[6-(1-phenylethenyl)-3-(2-phenylethenyl)indazol-1-yl]methoxy]ethyl]silane |
| SMILES | C=C(c1ccccc1)c1ccc2c(C=Cc3ccccc3)nn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C29H32N2OSi/c1-23(25-13-9-6-10-14-25)26-16-17-27-28(18-15-24-11-7-5-8-12-24)30-31(29(27)21-26)22-32-19-20-33(2,3)4/h5-18,21H,1,19-20,22H2,2-4H3 |
| InChIKey | TYAXHQJGDBBWGQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|