C26H26N2OS — CID 142037681
methyl-methylidene-[2-[[6-phenyl-3-[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl]-λ4-sulfane (PubChem CID 142037681) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is methyl-methylidene-[2-[[6-phenyl-3-[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl]-λ4-sulfane.
| Compound Name | methyl-methylidene-[2-[[6-phenyl-3-[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl]-λ4-sulfane |
|---|---|
| PubChem CID | 142037681 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | methyl-methylidene-[2-[[6-phenyl-3-[(E)-2-phenylethenyl]indazol-1-yl]methoxy]ethyl]-λ4-sulfane |
| SMILES | C=S(C)CCOCn1nc(/C=C/c2ccccc2)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H26N2OS/c1-30(2)18-17-29-20-28-26-19-23(22-11-7-4-8-12-22)14-15-24(26)25(27-28)16-13-21-9-5-3-6-10-21/h3-16,19H,1,17-18,20H2,2H3/b16-13+ |
| InChIKey | IHYGQDDBJBTAOA-DTQAZKPQSA-N |
| XLogP | 6.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|