C28H47N7O5 — CID 58987158
benzyl 4,7,10-tris[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carboxylate (PubChem CID 58987158) has the molecular formula C28H47N7O5 and a molecular weight of 561.73 g/mol. Its IUPAC name is benzyl 4,7,10-tris[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carboxylate.
| Compound Name | benzyl 4,7,10-tris[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carboxylate |
|---|---|
| PubChem CID | 58987158 |
| Molecular Formula | C28H47N7O5 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | benzyl 4,7,10-tris[2-(ethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carboxylate |
| SMILES | CCNC(=O)CN1CCN(CC(=O)NCC)CCN(C(=O)OCc2ccccc2)CCN(CC(=O)NCC)CC1 |
| InChI | InChI=1S/C28H47N7O5/c1-4-29-25(36)20-32-12-14-33(21-26(37)30-5-2)16-18-35(28(39)40-23-24-10-8-7-9-11-24)19-17-34(15-13-32)22-27(38)31-6-3/h7-11H,4-6,12-23H2,1-3H3,(H,29,36)(H,30,37)(H,31,38) |
| InChIKey | UEOUMPNOPSJQQU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |