C29H38BN3O4Si — CID 160812488
1-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-2-yl]-2-(2-trimethylsilylethoxymethyl)triazol-4-yl]ethanone (PubChem CID 160812488) has the molecular formula C29H38BN3O4Si and a molecular weight of 531.54 g/mol. Its IUPAC name is 1-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-2-yl]-2-(2-trimethylsilylethoxymethyl)triazol-4-yl]ethanone.
| Compound Name | 1-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-2-yl]-2-(2-trimethylsilylethoxymethyl)triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 160812488 |
| Molecular Formula | C29H38BN3O4Si |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 1-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-2-yl]-2-(2-trimethylsilylethoxymethyl)triazol-4-yl]ethanone |
| SMILES | CC(=O)c1nn(COCC[Si](C)(C)C)nc1-c1ccc2c(c1)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C29H38BN3O4Si/c1-19(34)26-27(32-33(31-26)18-35-13-14-38(6,7)8)20-9-11-24-21(15-20)16-22-17-23(10-12-25(22)24)30-36-28(2,3)29(4,5)37-30/h9-12,15,17H,13-14,16,18H2,1-8H3 |
| InChIKey | WBTXNCCFCNXAQX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|