C16H19BN2O5 — CID 174051367
3-acetyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylic acid (PubChem CID 174051367) has the molecular formula C16H19BN2O5 and a molecular weight of 330.15 g/mol. Its IUPAC name is 3-acetyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylic acid.
| Compound Name | 3-acetyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylic acid |
|---|---|
| PubChem CID | 174051367 |
| Molecular Formula | C16H19BN2O5 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-acetyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylic acid |
| SMILES | CC(=O)c1nn(C(=O)O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C16H19BN2O5/c1-9(20)13-11-8-10(6-7-12(11)19(18-13)14(21)22)17-23-15(2,3)16(4,5)24-17/h6-8H,1-5H3,(H,21,22) |
| InChIKey | FNGRFHYIAUIQQB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|