C15H20BIO4 — CID 163999084
2-[2-(methylidene-λ3-iodanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (PubChem CID 163999084) has the molecular formula C15H20BIO4 and a molecular weight of 402.04 g/mol. Its IUPAC name is 2-[2-(methylidene-λ3-iodanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid.
| Compound Name | 2-[2-(methylidene-λ3-iodanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 163999084 |
| Molecular Formula | C15H20BIO4 |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[2-(methylidene-λ3-iodanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| SMILES | C=Ic1ccc(B2OC(C)(C)C(C)(C)O2)cc1CC(=O)O |
| InChI | InChI=1S/C15H20BIO4/c1-14(2)15(3,4)21-16(20-14)11-6-7-12(17-5)10(8-11)9-13(18)19/h6-8H,5,9H2,1-4H3,(H,18,19) |
| InChIKey | UHIOHOQSAPKACO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|