C16H20BNO5 — CID 174144249
4-(hydroxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid (PubChem CID 174144249) has the molecular formula C16H20BNO5 and a molecular weight of 317.15 g/mol. Its IUPAC name is 4-(hydroxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid.
| Compound Name | 4-(hydroxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid |
|---|---|
| PubChem CID | 174144249 |
| Molecular Formula | C16H20BNO5 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-(hydroxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid |
| SMILES | CC1(C)OB(c2cc(CO)c3ccn(C(=O)O)c3c2)OC1(C)C |
| InChI | InChI=1S/C16H20BNO5/c1-15(2)16(3,4)23-17(22-15)11-7-10(9-19)12-5-6-18(14(20)21)13(12)8-11/h5-8,19H,9H2,1-4H3,(H,20,21) |
| InChIKey | OUHAAOLSIMPKEO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|