C15H21BN2O3 — CID 178051117
[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]methanol (PubChem CID 178051117) has the molecular formula C15H21BN2O3 and a molecular weight of 288.16 g/mol. Its IUPAC name is [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]methanol.
| Compound Name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]methanol |
|---|---|
| PubChem CID | 178051117 |
| Molecular Formula | C15H21BN2O3 |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]methanol |
| SMILES | Cn1cc2cc(B3OC(C)(C)C(C)(C)O3)cc(CO)c2n1 |
| InChI | InChI=1S/C15H21BN2O3/c1-14(2)15(3,4)21-16(20-14)12-6-10-8-18(5)17-13(10)11(7-12)9-19/h6-8,19H,9H2,1-5H3 |
| InChIKey | HWOYQUZQNBUXSG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|