C16H20BF3N2O3 — CID 178050796
2,2,2-trifluoro-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]ethanol (PubChem CID 178050796) has the molecular formula C16H20BF3N2O3 and a molecular weight of 356.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]ethanol |
|---|---|
| PubChem CID | 178050796 |
| Molecular Formula | C16H20BF3N2O3 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-7-yl]ethanol |
| SMILES | Cn1cc2cc(B3OC(C)(C)C(C)(C)O3)cc(C(O)C(F)(F)F)c2n1 |
| InChI | InChI=1S/C16H20BF3N2O3/c1-14(2)15(3,4)25-17(24-14)10-6-9-8-22(5)21-12(9)11(7-10)13(23)16(18,19)20/h6-8,13,23H,1-5H3 |
| InChIKey | RVYKHPYKTVQONZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|