C15H21BO4 — CID 169261643
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-7-yl]methanol (PubChem CID 169261643) has the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-7-yl]methanol.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-7-yl]methanol |
|---|---|
| PubChem CID | 169261643 |
| Molecular Formula | C15H21BO4 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-7-yl]methanol |
| SMILES | CC1(C)OB(c2cc(CO)c3c(c2)CCO3)OC1(C)C |
| InChI | InChI=1S/C15H21BO4/c1-14(2)15(3,4)20-16(19-14)12-7-10-5-6-18-13(10)11(8-12)9-17/h7-8,17H,5-6,9H2,1-4H3 |
| InChIKey | RCYJQRLKSZUDJM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|