C21H23BF2N2O3 — CID 171528186
6-[(1R)-1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 171528186) has the molecular formula C21H23BF2N2O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is 6-[(1R)-1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[(1R)-1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 171528186 |
| Molecular Formula | C21H23BF2N2O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-[(1R)-1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | C[C@H](c1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F)N1Cc2ncccc2C1=O |
| InChI | InChI=1S/C21H23BF2N2O3/c1-12(26-11-17-14(19(26)27)7-6-8-25-17)18-15(23)9-13(10-16(18)24)22-28-20(2,3)21(4,5)29-22/h6-10,12H,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | CSPVWGVUSFNVCM-GFCCVEGCSA-N |
| XLogP | 3.38 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|