C25H30BFN2O3 — CID 171527988
6-[[2-cyclopentyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 171527988) has the molecular formula C25H30BFN2O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is 6-[[2-cyclopentyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 6-[[2-cyclopentyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 171527988 |
| Molecular Formula | C25H30BFN2O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 6-[[2-cyclopentyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | CC1(C)OB(c2cc(F)c(CN3Cc4cccnc4C3=O)c(C3CCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C25H30BFN2O3/c1-24(2)25(3,4)32-26(31-24)18-12-19(16-8-5-6-9-16)20(21(27)13-18)15-29-14-17-10-7-11-28-22(17)23(29)30/h7,10-13,16H,5-6,8-9,14-15H2,1-4H3 |
| InChIKey | RXXQRTQXZVRNNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|