C14H21BO2 — CID 151417335
4-ethyl-4,5,5-trimethyl-2-(4-methylidenecyclohexa-1,5-dien-1-yl)-1,3,2-dioxaborolane (PubChem CID 151417335) has the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. Its IUPAC name is 4-ethyl-4,5,5-trimethyl-2-(4-methylidenecyclohexa-1,5-dien-1-yl)-1,3,2-dioxaborolane.
| Compound Name | 4-ethyl-4,5,5-trimethyl-2-(4-methylidenecyclohexa-1,5-dien-1-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 151417335 |
| Molecular Formula | C14H21BO2 |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-ethyl-4,5,5-trimethyl-2-(4-methylidenecyclohexa-1,5-dien-1-yl)-1,3,2-dioxaborolane |
| SMILES | C=C1C=CC(B2OC(C)(C)C(C)(CC)O2)=CC1 |
| InChI | InChI=1S/C14H21BO2/c1-6-14(5)13(3,4)16-15(17-14)12-9-7-11(2)8-10-12/h7,9-10H,2,6,8H2,1,3-5H3 |
| InChIKey | OZUJUMXWPIENSI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|