C16H22BF3O2 — CID 162685531
4-ethyl-4,5,5-trimethyl-2-[4-(1,1,1-trifluoropropan-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 162685531) has the molecular formula C16H22BF3O2 and a molecular weight of 314.16 g/mol. Its IUPAC name is 4-ethyl-4,5,5-trimethyl-2-[4-(1,1,1-trifluoropropan-2-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4-ethyl-4,5,5-trimethyl-2-[4-(1,1,1-trifluoropropan-2-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162685531 |
| Molecular Formula | C16H22BF3O2 |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-ethyl-4,5,5-trimethyl-2-[4-(1,1,1-trifluoropropan-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CCC1(C)OB(c2ccc(C(C)C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C16H22BF3O2/c1-6-15(5)14(3,4)21-17(22-15)13-9-7-12(8-10-13)11(2)16(18,19)20/h7-11H,6H2,1-5H3 |
| InChIKey | JUOWKPMXKSZWKH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|