C17H25BF3NO3S — CID 153425139
(4R)-5,5,5-trifluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfinamide (PubChem CID 153425139) has the molecular formula C17H25BF3NO3S and a molecular weight of 391.26 g/mol. Its IUPAC name is (4R)-5,5,5-trifluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfinamide.
| Compound Name | (4R)-5,5,5-trifluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfinamide |
|---|---|
| PubChem CID | 153425139 |
| Molecular Formula | C17H25BF3NO3S |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (4R)-5,5,5-trifluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentane-2-sulfinamide |
| SMILES | CC(C[C@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(F)(F)F)S(N)=O |
| InChI | InChI=1S/C17H25BF3NO3S/c1-11(26(22)23)10-14(17(19,20)21)12-6-8-13(9-7-12)18-24-15(2,3)16(4,5)25-18/h6-9,11,14H,10,22H2,1-5H3/t11?,14-,26?/m1/s1 |
| InChIKey | MDIMWYWBZLQLJH-RYFODTHPSA-N |
| XLogP | 3.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|