C18H27BF3NO3S — CID 142754376
(S)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-2-sulfinamide (PubChem CID 142754376) has the molecular formula C18H27BF3NO3S and a molecular weight of 405.29 g/mol. Its IUPAC name is (S)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 142754376 |
| Molecular Formula | C18H27BF3NO3S |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (S)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H27BF3NO3S/c1-15(2,3)27(24)23-14(18(20,21)22)12-8-10-13(11-9-12)19-25-16(4,5)17(6,7)26-19/h8-11,14,23H,1-7H3/t14-,27+/m1/s1 |
| InChIKey | ARCMTYUUTQWCMC-ASHKIFAZSA-N |
| XLogP | 3.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|