C20H30BF3N2O3 — CID 67298367
(2S)-2-amino-4-methyl-N-[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pentanamide (PubChem CID 67298367) has the molecular formula C20H30BF3N2O3 and a molecular weight of 414.28 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 67298367 |
| Molecular Formula | C20H30BF3N2O3 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H30BF3N2O3/c1-12(2)11-15(25)17(27)26-16(20(22,23)24)13-7-9-14(10-8-13)21-28-18(3,4)19(5,6)29-21/h7-10,12,15-16H,11,25H2,1-6H3,(H,26,27)/t15-,16-/m0/s1 |
| InChIKey | SBZUWPHRXNZWSC-HOTGVXAUSA-N |
| XLogP | 3.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|