C20H28BF3N2O3 — CID 162468151
N-[2,2,2-trifluoro-1-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyrrolidine-1-carboxamide (PubChem CID 162468151) has the molecular formula C20H28BF3N2O3 and a molecular weight of 412.26 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2,2,2-trifluoro-1-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162468151 |
| Molecular Formula | C20H28BF3N2O3 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[2,2,2-trifluoro-1-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)N2CCCC2)C(F)(F)F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H28BF3N2O3/c1-13-8-9-14(12-15(13)21-28-18(2,3)19(4,5)29-21)16(20(22,23)24)25-17(27)26-10-6-7-11-26/h8-9,12,16H,6-7,10-11H2,1-5H3,(H,25,27) |
| InChIKey | SBNLERAWNYJRPW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|