C18H26BFN2O3 — CID 162764941
N-[2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 162764941) has the molecular formula C18H26BFN2O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is N-[2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162764941 |
| Molecular Formula | C18H26BFN2O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[2-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(F)c(NC(=O)N2CCCC2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BFN2O3/c1-12-10-14(20)15(21-16(23)22-8-6-7-9-22)11-13(12)19-24-17(2,3)18(4,5)25-19/h10-11H,6-9H2,1-5H3,(H,21,23) |
| InChIKey | URSQAAYBYNLUJJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|