C22H34BFN2O4 — CID 156706985
3-(2,2-dimethylpropyl)-N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxyazetidine-1-carboxamide (PubChem CID 156706985) has the molecular formula C22H34BFN2O4 and a molecular weight of 420.33 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxyazetidine-1-carboxamide.
| Compound Name | 3-(2,2-dimethylpropyl)-N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxyazetidine-1-carboxamide |
|---|---|
| PubChem CID | 156706985 |
| Molecular Formula | C22H34BFN2O4 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-hydroxyazetidine-1-carboxamide |
| SMILES | Cc1c(NC(=O)N2CC(O)(CC(C)(C)C)C2)cc(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BFN2O4/c1-14-16(23-29-20(5,6)21(7,8)30-23)9-15(24)10-17(14)25-18(27)26-12-22(28,13-26)11-19(2,3)4/h9-10,28H,11-13H2,1-8H3,(H,25,27) |
| InChIKey | JCGAOASUFWKUTK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|