C26H35BFNO4 — CID 145061626
ethane;N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethyl-2H-1-benzofuran-6-carboxamide (PubChem CID 145061626) has the molecular formula C26H35BFNO4 and a molecular weight of 455.38 g/mol. Its IUPAC name is ethane;N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethyl-2H-1-benzofuran-6-carboxamide.
| Compound Name | ethane;N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethyl-2H-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 145061626 |
| Molecular Formula | C26H35BFNO4 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | ethane;N-[5-fluoro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,3-dimethyl-2H-1-benzofuran-6-carboxamide |
| SMILES | CC.Cc1c(NC(=O)c2ccc3c(c2)OCC3(C)C)cc(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H29BFNO4.C2H6/c1-14-18(25-30-23(4,5)24(6,7)31-25)11-16(26)12-19(14)27-21(28)15-8-9-17-20(10-15)29-13-22(17,2)3;1-2/h8-12H,13H2,1-7H3,(H,27,28);1-2H3 |
| InChIKey | KHZWOKBXTJUIOO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|