C38H42B2N2O6 — CID 132518972
N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 132518972) has the molecular formula C38H42B2N2O6 and a molecular weight of 644.39 g/mol. Its IUPAC name is N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 132518972 |
| Molecular Formula | C38H42B2N2O6 |
| Molecular Weight | 644.39 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-[4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | CC1(C)OB(c2ccccc2NC(=O)c2ccc(-c3ccc(C(=O)Nc4ccccc4B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C38H42B2N2O6/c1-35(2)36(3,4)46-39(45-35)29-13-9-11-15-31(29)41-33(43)27-21-17-25(18-22-27)26-19-23-28(24-20-26)34(44)42-32-16-12-10-14-30(32)40-47-37(5,6)38(7,8)48-40/h9-24H,1-8H3,(H,41,43)(H,42,44) |
| InChIKey | FEOOOTLVZHLGGL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|