C25H27BN2O4 — CID 175585090
4-pyrrol-1-yl-N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-4-yl]benzamide (PubChem CID 175585090) has the molecular formula C25H27BN2O4 and a molecular weight of 430.31 g/mol. Its IUPAC name is 4-pyrrol-1-yl-N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-4-yl]benzamide.
| Compound Name | 4-pyrrol-1-yl-N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-4-yl]benzamide |
|---|---|
| PubChem CID | 175585090 |
| Molecular Formula | C25H27BN2O4 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-pyrrol-1-yl-N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-4-yl]benzamide |
| SMILES | CC1(C)OB(c2ccc(NC(=O)c3ccc(-n4cccc4)cc3)c3c2OCC3)OC1(C)C |
| InChI | InChI=1S/C25H27BN2O4/c1-24(2)25(3,4)32-26(31-24)20-11-12-21(19-13-16-30-22(19)20)27-23(29)17-7-9-18(10-8-17)28-14-5-6-15-28/h5-12,14-15H,13,16H2,1-4H3,(H,27,29) |
| InChIKey | QTIXRNJQAYVPQG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|