C29H39BFNO4Si — CID 68821869
CID 68821869 (PubChem CID 68821869) has the molecular formula C29H39BFNO4Si and a molecular weight of 523.53 g/mol.
| Compound Name | CID 68821869 |
|---|---|
| PubChem CID | 68821869 |
| Molecular Formula | C29H39BFNO4Si |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1c(NC(=O)c2ccc(C3(F)CC3)cc2)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H39BFNO4Si/c1-25(2,3)37-36-26(4,5)23-21(30-34-27(6,7)28(8,9)35-30)11-10-12-22(23)32-24(33)19-13-15-20(16-14-19)29(31)17-18-29/h10-16H,17-18H2,1-9H3,(H,32,33) |
| InChIKey | RAGPVLCNJHBXHF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|