C28H41BN2O4Si — CID 90071631
6-cyclopropyl-N-[2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 90071631) has the molecular formula C28H41BN2O4Si and a molecular weight of 508.54 g/mol. Its IUPAC name is 6-cyclopropyl-N-[2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-cyclopropyl-N-[2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90071631 |
| Molecular Formula | C28H41BN2O4Si |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 6-cyclopropyl-N-[2-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2cccc(NC(=O)c3ccc(C4CC4)nc3)c2CCC(C)(C)[Si](C)(C)O)OC1(C)C |
| InChI | InChI=1S/C28H41BN2O4Si/c1-26(2,36(7,8)33)17-16-21-22(29-34-27(3,4)28(5,6)35-29)10-9-11-24(21)31-25(32)20-14-15-23(30-18-20)19-12-13-19/h9-11,14-15,18-19,33H,12-13,16-17H2,1-8H3,(H,31,32) |
| InChIKey | HGFPXWZUJQSBMJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|