C27H30BN3O3 — CID 169024758
2-cyclopropyl-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 169024758) has the molecular formula C27H30BN3O3 and a molecular weight of 455.37 g/mol. Its IUPAC name is 2-cyclopropyl-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169024758 |
| Molecular Formula | C27H30BN3O3 |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-cyclopropyl-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | Cc1ncc(NC(=O)c2ccnc(C3CC3)c2)cc1-c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C27H30BN3O3/c1-17-23(19-7-6-8-21(13-19)28-33-26(2,3)27(4,5)34-28)15-22(16-30-17)31-25(32)20-11-12-29-24(14-20)18-9-10-18/h6-8,11-16,18H,9-10H2,1-5H3,(H,31,32) |
| InChIKey | PCCCRFHKQOAUEP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|