C29H29BN4O3 — CID 174076787
2-(2-cyanopropan-2-yl)-N-[4-cyano-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide (PubChem CID 174076787) has the molecular formula C29H29BN4O3 and a molecular weight of 492.39 g/mol. Its IUPAC name is 2-(2-cyanopropan-2-yl)-N-[4-cyano-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-cyanopropan-2-yl)-N-[4-cyano-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 174076787 |
| Molecular Formula | C29H29BN4O3 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-(2-cyanopropan-2-yl)-N-[4-cyano-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide |
| SMILES | CC(C)(C#N)c1cc(C(=O)Nc2ccc(C#N)c(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)c2)ccn1 |
| InChI | InChI=1S/C29H29BN4O3/c1-27(2,18-32)25-15-20(12-13-33-25)26(35)34-23-11-10-21(17-31)24(16-23)19-8-7-9-22(14-19)30-36-28(3,4)29(5,6)37-30/h7-16H,1-6H3,(H,34,35) |
| InChIKey | KNVWVEMEDPKXDP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|