C30H37BN2O3 — CID 168929975
2-tert-butyl-N-[4-methyl-3-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide (PubChem CID 168929975) has the molecular formula C30H37BN2O3 and a molecular weight of 484.45 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-methyl-3-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-tert-butyl-N-[4-methyl-3-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 168929975 |
| Molecular Formula | C30H37BN2O3 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 2-tert-butyl-N-[4-methyl-3-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(-c2cc(NC(=O)c3ccnc(C(C)(C)C)c3)ccc2C)c1 |
| InChI | InChI=1S/C30H37BN2O3/c1-19-14-22(16-23(15-19)31-35-29(6,7)30(8,9)36-31)25-18-24(11-10-20(25)2)33-27(34)21-12-13-32-26(17-21)28(3,4)5/h10-18H,1-9H3,(H,33,34) |
| InChIKey | AZQDFBPOIQFOSV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|