C19H12ClF4N3O — CID 168929406
N-[3-(2-chloro-6-fluoro-4-pyridinyl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 168929406) has the molecular formula C19H12ClF4N3O and a molecular weight of 409.77 g/mol. Its IUPAC name is N-[3-(2-chloro-6-fluoro-4-pyridinyl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-(2-chloro-6-fluoro-4-pyridinyl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 168929406 |
| Molecular Formula | C19H12ClF4N3O |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[3-(2-chloro-6-fluoro-4-pyridinyl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1cc(F)nc(Cl)c1 |
| InChI | InChI=1S/C19H12ClF4N3O/c1-10-2-3-13(9-14(10)12-7-16(20)27-17(21)8-12)26-18(28)11-4-5-25-15(6-11)19(22,23)24/h2-9H,1H3,(H,26,28) |
| InChIKey | BRSZIYQNAZBQOK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|