C22H18F3N5O — CID 140809737
N-[3-[5-[cyano(ethyl)amino]-3-pyridinyl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 140809737) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is N-[3-[5-[cyano(ethyl)amino]-3-pyridinyl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[5-[cyano(ethyl)amino]-3-pyridinyl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140809737 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[3-[5-[cyano(ethyl)amino]-3-pyridinyl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CCN(C#N)c1cncc(-c2cc(NC(=O)c3ccnc(C(F)(F)F)c3)ccc2C)c1 |
| InChI | InChI=1S/C22H18F3N5O/c1-3-30(13-26)18-8-16(11-27-12-18)19-10-17(5-4-14(19)2)29-21(31)15-6-7-28-20(9-15)22(23,24)25/h4-12H,3H2,1-2H3,(H,29,31) |
| InChIKey | HBQYUADVTKGSGN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|